C15H8F4N2O3S2 — CID 8013057
2,3,4,5-tetrafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 8013057) has the molecular formula C15H8F4N2O3S2 and a molecular weight of 404.37 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8013057 |
| Molecular Formula | C15H8F4N2O3S2 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)c3cc(F)c(F)c(F)c3F)sc2c1 |
| InChI | InChI=1S/C15H8F4N2O3S2/c1-26(23,24)6-2-3-9-10(4-6)25-15(20-9)21-14(22)7-5-8(16)12(18)13(19)11(7)17/h2-5H,1H3,(H,20,21,22) |
| InChIKey | ZZRKCPFDYSHSDK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|