C15H10F2N2O3S2 — CID 47086370
N-(5,6-difluoro-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzamide (PubChem CID 47086370) has the molecular formula C15H10F2N2O3S2 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(5,6-difluoro-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(5,6-difluoro-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 47086370 |
| Molecular Formula | C15H10F2N2O3S2 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | N-(5,6-difluoro-1,3-benzothiazol-2-yl)-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2nc3cc(F)c(F)cc3s2)c1 |
| InChI | InChI=1S/C15H10F2N2O3S2/c1-24(21,22)9-4-2-3-8(5-9)14(20)19-15-18-12-6-10(16)11(17)7-13(12)23-15/h2-7H,1H3,(H,18,19,20) |
| InChIKey | BYTZDUFMBAYJSY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |