C16H14N2O3S3 — CID 7565342
4-methylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7565342) has the molecular formula C16H14N2O3S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-methylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-methylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7565342 |
| Molecular Formula | C16H14N2O3S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 4-methylsulfanyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CSc1ccc(C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)cc1 |
| InChI | InChI=1S/C16H14N2O3S3/c1-22-11-5-3-10(4-6-11)15(19)18-16-17-13-8-7-12(24(2,20)21)9-14(13)23-16/h3-9H,1-2H3,(H,17,18,19) |
| InChIKey | IVPZHBNKHHRUTL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |