C18H26N2O3S2 — CID 4674921
N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)decanamide (PubChem CID 4674921) has the molecular formula C18H26N2O3S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)decanamide.
| Compound Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)decanamide |
|---|---|
| PubChem CID | 4674921 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1nc2ccc(S(C)(=O)=O)cc2s1 |
| InChI | InChI=1S/C18H26N2O3S2/c1-3-4-5-6-7-8-9-10-17(21)20-18-19-15-12-11-14(25(2,22)23)13-16(15)24-18/h11-13H,3-10H2,1-2H3,(H,19,20,21) |
| InChIKey | PGROFWUESKUOLK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|