C13H15BrN2OS — CID 5058354
N-(6-bromo-1,3-benzothiazol-2-yl)hexanamide (PubChem CID 5058354) has the molecular formula C13H15BrN2OS and a molecular weight of 327.25 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 5058354 |
| Molecular Formula | C13H15BrN2OS |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C13H15BrN2OS/c1-2-3-4-5-12(17)16-13-15-10-7-6-9(14)8-11(10)18-13/h6-8H,2-5H2,1H3,(H,15,16,17) |
| InChIKey | UUGOCTAKYWWOBV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|