C17H14BrFN2OS2 — CID 41086909
N-(6-bromo-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 41086909) has the molecular formula C17H14BrFN2OS2 and a molecular weight of 425.35 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086909 |
| Molecular Formula | C17H14BrFN2OS2 |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | O=C(CCCSc1ccc(F)cc1)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C17H14BrFN2OS2/c18-11-3-8-14-15(10-11)24-17(20-14)21-16(22)2-1-9-23-13-6-4-12(19)5-7-13/h3-8,10H,1-2,9H2,(H,20,21,22) |
| InChIKey | KNHUVRZPRAWQOE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|