C20H19FN2O3S2 — CID 41271750
ethyl 2-[4-(4-fluorophenyl)sulfanylbutanoylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 41271750) has the molecular formula C20H19FN2O3S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 2-[4-(4-fluorophenyl)sulfanylbutanoylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[4-(4-fluorophenyl)sulfanylbutanoylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 41271750 |
| Molecular Formula | C20H19FN2O3S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | ethyl 2-[4-(4-fluorophenyl)sulfanylbutanoylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)CCCSc3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C20H19FN2O3S2/c1-2-26-19(25)13-5-10-16-17(12-13)28-20(22-16)23-18(24)4-3-11-27-15-8-6-14(21)7-9-15/h5-10,12H,2-4,11H2,1H3,(H,22,23,24) |
| InChIKey | SRHUTTXZYJQTAC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|