C19H18N2O3S2 — CID 41085873
methyl 2-(4-phenylsulfanylbutanoylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 41085873) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl 2-(4-phenylsulfanylbutanoylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(4-phenylsulfanylbutanoylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 41085873 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | methyl 2-(4-phenylsulfanylbutanoylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=O)CCCSc3ccccc3)sc2c1 |
| InChI | InChI=1S/C19H18N2O3S2/c1-24-18(23)13-9-10-15-16(12-13)26-19(20-15)21-17(22)8-5-11-25-14-6-3-2-4-7-14/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,20,21,22) |
| InChIKey | RVLBSIHQYGNQQS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|