C18H14N2O3S — CID 4615368
methyl 2-(3-phenylprop-2-enoylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 4615368) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 2-(3-phenylprop-2-enoylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(3-phenylprop-2-enoylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4615368 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 2-(3-phenylprop-2-enoylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=O)C=Cc3ccccc3)sc2c1 |
| InChI | InChI=1S/C18H14N2O3S/c1-23-17(22)13-8-9-14-15(11-13)24-18(19-14)20-16(21)10-7-12-5-3-2-4-6-12/h2-11H,1H3,(H,19,20,21) |
| InChIKey | GDDRSPGVXXFLQS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|