C24H24N4O4S — CID 108743760
methyl 4-[(E)-3-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-oxoprop-1-enyl]benzoate (PubChem CID 108743760) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is methyl 4-[(E)-3-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 108743760 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 4-[(E)-3-[[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]amino]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)Nc2nc3ccc(C(=O)N4CCN(C)CC4)cc3s2)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-27-11-13-28(14-12-27)22(30)18-8-9-19-20(15-18)33-24(25-19)26-21(29)10-5-16-3-6-17(7-4-16)23(31)32-2/h3-10,15H,11-14H2,1-2H3,(H,25,26,29)/b10-5+ |
| InChIKey | RJLZHVKIOBTGAB-BJMVGYQFSA-N |
| XLogP | 3.12 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|