C16H21N5OS2 — CID 108783383
1-ethyl-3-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]thiourea (PubChem CID 108783383) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-ethyl-3-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]thiourea.
| Compound Name | 1-ethyl-3-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]thiourea |
|---|---|
| PubChem CID | 108783383 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-ethyl-3-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]thiourea |
| SMILES | CCNC(=S)Nc1nc2ccc(C(=O)N3CCN(C)CC3)cc2s1 |
| InChI | InChI=1S/C16H21N5OS2/c1-3-17-15(23)19-16-18-12-5-4-11(10-13(12)24-16)14(22)21-8-6-20(2)7-9-21/h4-5,10H,3,6-9H2,1-2H3,(H2,17,18,19,23) |
| InChIKey | RPWYVQYYOSZZLY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|