C22H21ClN4O2S — CID 108766130
(E)-3-(3-chlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide (PubChem CID 108766130) has the molecular formula C22H21ClN4O2S and a molecular weight of 440.96 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108766130 |
| Molecular Formula | C22H21ClN4O2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
| SMILES | CN1CCN(C(=O)c2ccc3nc(NC(=O)/C=C/c4cccc(Cl)c4)sc3c2)CC1 |
| InChI | InChI=1S/C22H21ClN4O2S/c1-26-9-11-27(12-10-26)21(29)16-6-7-18-19(14-16)30-22(24-18)25-20(28)8-5-15-3-2-4-17(23)13-15/h2-8,13-14H,9-12H2,1H3,(H,24,25,28)/b8-5+ |
| InChIKey | VPLZNBJOBJZJKL-VMPITWQZSA-N |
| XLogP | 3.99 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|