C22H20Cl2N4O2S — CID 108766143
(E)-3-(3,4-dichlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide (PubChem CID 108766143) has the molecular formula C22H20Cl2N4O2S and a molecular weight of 475.40 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108766143 |
| Molecular Formula | C22H20Cl2N4O2S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[6-(4-methylpiperazine-1-carbonyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
| SMILES | CN1CCN(C(=O)c2ccc3nc(NC(=O)/C=C/c4ccc(Cl)c(Cl)c4)sc3c2)CC1 |
| InChI | InChI=1S/C22H20Cl2N4O2S/c1-27-8-10-28(11-9-27)21(30)15-4-6-18-19(13-15)31-22(25-18)26-20(29)7-3-14-2-5-16(23)17(24)12-14/h2-7,12-13H,8-11H2,1H3,(H,25,26,29)/b7-3+ |
| InChIKey | DWMPUAXTCMDGFJ-XVNBXDOJSA-N |
| XLogP | 4.64 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|