C21H21Cl2N3O2 — CID 54858889
(E)-N-[2-chloro-5-(4-methylpiperazine-1-carbonyl)phenyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 54858889) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is (E)-N-[2-chloro-5-(4-methylpiperazine-1-carbonyl)phenyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-chloro-5-(4-methylpiperazine-1-carbonyl)phenyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54858889 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (E)-N-[2-chloro-5-(4-methylpiperazine-1-carbonyl)phenyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CN1CCN(C(=O)c2ccc(Cl)c(NC(=O)/C=C/c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-25-10-12-26(13-11-25)21(28)16-5-8-18(23)19(14-16)24-20(27)9-4-15-2-6-17(22)7-3-15/h2-9,14H,10-13H2,1H3,(H,24,27)/b9-4+ |
| InChIKey | UFXLWFCFGJLSIX-RUDMXATFSA-N |
| XLogP | 4.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|