C23H23ClF3N3O3 — CID 76871548
3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 76871548) has the molecular formula C23H23ClF3N3O3 and a molecular weight of 481.90 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76871548 |
| Molecular Formula | C23H23ClF3N3O3 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C(=O)N2CCN(C)CC2)cc1NC(=O)C=Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C23H23ClF3N3O3/c1-29-9-11-30(12-10-29)22(32)16-3-7-20(33-2)19(14-16)28-21(31)8-4-15-13-17(23(25,26)27)5-6-18(15)24/h3-8,13-14H,9-12H2,1-2H3,(H,28,31) |
| InChIKey | FLOHGMPULBWVCB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|