C21H18ClF3N2O3 — CID 76884317
3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide (PubChem CID 76884317) has the molecular formula C21H18ClF3N2O3 and a molecular weight of 438.83 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76884317 |
| Molecular Formula | C21H18ClF3N2O3 |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cc(C(F)(F)F)ccc1Cl)Nc1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H18ClF3N2O3/c22-18-7-4-16(21(23,24)25)13-15(18)3-8-19(28)26-17-5-1-14(2-6-17)20(29)27-9-11-30-12-10-27/h1-8,13H,9-12H2,(H,26,28) |
| InChIKey | CINZDNFECSLZLC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|