C20H18ClF3N2O3 — CID 33257278
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 33257278) has the molecular formula C20H18ClF3N2O3 and a molecular weight of 426.82 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 33257278 |
| Molecular Formula | C20H18ClF3N2O3 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | CN(C)C(=O)COc1ccc(NC(=O)/C=C/c2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O3/c1-26(2)19(28)12-29-16-7-5-15(6-8-16)25-18(27)10-3-13-11-14(20(22,23)24)4-9-17(13)21/h3-11H,12H2,1-2H3,(H,25,27)/b10-3+ |
| InChIKey | JZTMMJBBIFBNHO-XCVCLJGOSA-N |
| XLogP | 4.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|