C18H15ClF3NO2 — CID 7959642
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 7959642) has the molecular formula C18H15ClF3NO2 and a molecular weight of 369.77 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 7959642 |
| Molecular Formula | C18H15ClF3NO2 |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H15ClF3NO2/c1-25-15-6-2-12(3-7-15)11-23-17(24)9-4-13-10-14(18(20,21)22)5-8-16(13)19/h2-10H,11H2,1H3,(H,23,24)/b9-4+ |
| InChIKey | YVAMMTUQSZBKJG-RUDMXATFSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|