C19H16ClF3N2O2 — CID 55676176
(E)-N-[2-(benzylamino)-2-oxoethyl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 55676176) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is (E)-N-[2-(benzylamino)-2-oxoethyl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(benzylamino)-2-oxoethyl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55676176 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (E)-N-[2-(benzylamino)-2-oxoethyl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)NCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c20-16-8-7-15(19(21,22)23)10-14(16)6-9-17(26)25-12-18(27)24-11-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,24,27)(H,25,26)/b9-6+ |
| InChIKey | PMKSFPBDSONVIS-RMKNXTFCSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|