C21H18ClF3N2O2 — CID 86881651
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]prop-2-enamide (PubChem CID 86881651) has the molecular formula C21H18ClF3N2O2 and a molecular weight of 422.83 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 86881651 |
| Molecular Formula | C21H18ClF3N2O2 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)NCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H18ClF3N2O2/c22-18-7-6-17(21(23,24)25)11-15(18)5-8-19(28)26-12-20(29)27-10-9-14-3-1-2-4-16(14)13-27/h1-8,11H,9-10,12-13H2,(H,26,28)/b8-5+ |
| InChIKey | ODMSAULUTANWTF-VMPITWQZSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|