C22H21F3N2O2 — CID 176734344
(E)-N-[2-(4-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 176734344) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is (E)-N-[2-(4-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 176734344 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (E)-N-[2-(4-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC1CN(C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C22H21F3N2O2/c1-15-13-27(14-17-4-2-3-5-19(15)17)21(29)12-26-20(28)11-8-16-6-9-18(10-7-16)22(23,24)25/h2-11,15H,12-14H2,1H3,(H,26,28)/b11-8+ |
| InChIKey | DSZFALBUJPIMEI-DHZHZOJOSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|