C17H20F3N3O4S — CID 176761320
(E)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 176761320) has the molecular formula C17H20F3N3O4S and a molecular weight of 419.43 g/mol. Its IUPAC name is (E)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 176761320 |
| Molecular Formula | C17H20F3N3O4S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (E)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H20F3N3O4S/c1-28(26,27)23-10-8-22(9-11-23)16(25)12-21-15(24)7-4-13-2-5-14(6-3-13)17(18,19)20/h2-7H,8-12H2,1H3,(H,21,24)/b7-4+ |
| InChIKey | XCBOMOYPJLJSBX-QPJJXVBHSA-N |
| XLogP | 0.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|