C16H19ClFN3O4S — CID 155194895
(E)-3-(3-chloro-4-fluorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide (PubChem CID 155194895) has the molecular formula C16H19ClFN3O4S and a molecular weight of 403.86 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 155194895 |
| Molecular Formula | C16H19ClFN3O4S |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CNC(=O)/C=C/c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H19ClFN3O4S/c1-26(24,25)21-8-6-20(7-9-21)16(23)11-19-15(22)5-3-12-2-4-14(18)13(17)10-12/h2-5,10H,6-9,11H2,1H3,(H,19,22)/b5-3+ |
| InChIKey | DCAXHOMNLATHJE-HWKANZROSA-N |
| XLogP | 0.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|