C12H13ClN2O2 — CID 9296462
(E)-N-(2-amino-2-oxoethyl)-3-(3-chloro-4-methylphenyl)prop-2-enamide (PubChem CID 9296462) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is (E)-N-(2-amino-2-oxoethyl)-3-(3-chloro-4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-amino-2-oxoethyl)-3-(3-chloro-4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9296462 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (E)-N-(2-amino-2-oxoethyl)-3-(3-chloro-4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCC(N)=O)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O2/c1-8-2-3-9(6-10(8)13)4-5-12(17)15-7-11(14)16/h2-6H,7H2,1H3,(H2,14,16)(H,15,17)/b5-4+ |
| InChIKey | XUNRTNGMLSJGBS-SNAWJCMRSA-N |
| XLogP | 1.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|