C15H18ClNO3 — CID 81369875
3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 81369875) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 81369875 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[[(E)-3-(3-chloro-4-methylphenyl)prop-2-enoyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)NCC(C)(C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C15H18ClNO3/c1-10-4-5-11(8-12(10)16)6-7-13(18)17-9-15(2,3)14(19)20/h4-8H,9H2,1-3H3,(H,17,18)(H,19,20)/b7-6+ |
| InChIKey | PXCRUOSUAIWLML-VOTSOKGWSA-N |
| XLogP | 2.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|