C15H17ClFNO2 — CID 114630878
(E)-3-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide (PubChem CID 114630878) has the molecular formula C15H17ClFNO2 and a molecular weight of 297.76 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide |
|---|---|
| PubChem CID | 114630878 |
| Molecular Formula | C15H17ClFNO2 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-N-(3-hydroxy-2,2-dimethylcyclobutyl)prop-2-enamide |
| SMILES | CC1(C)C(O)CC1NC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClFNO2/c1-15(2)12(8-13(15)19)18-14(20)6-4-9-3-5-11(17)10(16)7-9/h3-7,12-13,19H,8H2,1-2H3,(H,18,20)/b6-4+ |
| InChIKey | WLSQWKDBPRCEFX-GQCTYLIASA-N |
| XLogP | 2.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|