C15H17ClFNO2 — CID 43388724
(E)-3-(3-chloro-4-fluorophenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide (PubChem CID 43388724) has the molecular formula C15H17ClFNO2 and a molecular weight of 297.76 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 43388724 |
| Molecular Formula | C15H17ClFNO2 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C15H17ClFNO2/c16-13-9-10(1-7-14(13)17)2-8-15(20)18-11-3-5-12(19)6-4-11/h1-2,7-9,11-12,19H,3-6H2,(H,18,20)/b8-2+ |
| InChIKey | AFOMRSZRQBIKEO-KRXBUXKQSA-N |
| XLogP | 2.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|