C14H14ClFN2O4S — CID 9083384
(3S)-N'-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9083384) has the molecular formula C14H14ClFN2O4S and a molecular weight of 360.79 g/mol. Its IUPAC name is (3S)-N'-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3S)-N'-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9083384 |
| Molecular Formula | C14H14ClFN2O4S |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (3S)-N'-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)NNC(=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14ClFN2O4S/c15-11-7-9(1-3-12(11)16)2-4-13(19)17-18-14(20)10-5-6-23(21,22)8-10/h1-4,7,10H,5-6,8H2,(H,17,19)(H,18,20)/b4-2+/t10-/m1/s1 |
| InChIKey | PWIQNELSANGJNP-XCRNYIDWSA-N |
| XLogP | 1.07 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|