C15H15ClN2O6S — CID 9083425
(3R)-N'-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9083425) has the molecular formula C15H15ClN2O6S and a molecular weight of 386.81 g/mol. Its IUPAC name is (3R)-N'-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3R)-N'-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9083425 |
| Molecular Formula | C15H15ClN2O6S |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (3R)-N'-[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)NNC(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15ClN2O6S/c16-11-5-9(6-12-14(11)24-8-23-12)1-2-13(19)17-18-15(20)10-3-4-25(21,22)7-10/h1-2,5-6,10H,3-4,7-8H2,(H,17,19)(H,18,20)/b2-1+/t10-/m0/s1 |
| InChIKey | IQHCZBSDYYFTCO-YOLVWIGZSA-N |
| XLogP | 0.66 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|