C15H17FN2O5S — CID 9142041
(3R)-N'-[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9142041) has the molecular formula C15H17FN2O5S and a molecular weight of 356.38 g/mol. Its IUPAC name is (3R)-N'-[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3R)-N'-[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9142041 |
| Molecular Formula | C15H17FN2O5S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3R)-N'-[(E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoyl]-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | COc1ccc(/C=C/C(=O)NNC(=O)[C@H]2CCS(=O)(=O)C2)cc1F |
| InChI | InChI=1S/C15H17FN2O5S/c1-23-13-4-2-10(8-12(13)16)3-5-14(19)17-18-15(20)11-6-7-24(21,22)9-11/h2-5,8,11H,6-7,9H2,1H3,(H,17,19)(H,18,20)/b5-3+/t11-/m0/s1 |
| InChIKey | ACQKVBFJJGYWIO-TZNOJPMFSA-N |
| XLogP | 0.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|