C13H15FN2O5S — CID 9083434
(3R)-N'-(2-fluoro-4-methoxybenzoyl)-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9083434) has the molecular formula C13H15FN2O5S and a molecular weight of 330.34 g/mol. Its IUPAC name is (3R)-N'-(2-fluoro-4-methoxybenzoyl)-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3R)-N'-(2-fluoro-4-methoxybenzoyl)-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9083434 |
| Molecular Formula | C13H15FN2O5S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (3R)-N'-(2-fluoro-4-methoxybenzoyl)-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)[C@H]2CCS(=O)(=O)C2)c(F)c1 |
| InChI | InChI=1S/C13H15FN2O5S/c1-21-9-2-3-10(11(14)6-9)13(18)16-15-12(17)8-4-5-22(19,20)7-8/h2-3,6,8H,4-5,7H2,1H3,(H,15,17)(H,16,18)/t8-/m0/s1 |
| InChIKey | PUPHHWPCOSUCMM-QMMMGPOBSA-N |
| XLogP | 0.03 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|