C16H17N3O4S — CID 9082780
N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methylquinoline-4-carbohydrazide (PubChem CID 9082780) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methylquinoline-4-carbohydrazide.
| Compound Name | N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 9082780 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methylquinoline-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)[C@@H]2CCS(=O)(=O)C2)c2ccccc2n1 |
| InChI | InChI=1S/C16H17N3O4S/c1-10-8-13(12-4-2-3-5-14(12)17-10)16(21)19-18-15(20)11-6-7-24(22,23)9-11/h2-5,8,11H,6-7,9H2,1H3,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | KFOZCMPPLYLUIN-LLVKDONJSA-N |
| XLogP | 0.74 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|