C20H19N3O2 — CID 38202874
N-(2-benzamidoethyl)-2-methylquinoline-4-carboxamide (PubChem CID 38202874) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-2-methylquinoline-4-carboxamide.
| Compound Name | N-(2-benzamidoethyl)-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 38202874 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(2-benzamidoethyl)-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCNC(=O)c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C20H19N3O2/c1-14-13-17(16-9-5-6-10-18(16)23-14)20(25)22-12-11-21-19(24)15-7-3-2-4-8-15/h2-10,13H,11-12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | YHHKXBMNXNJFMH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|