C19H22N4O — CID 2564973
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylquinoline-4-carboxamide (PubChem CID 2564973) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylquinoline-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2564973 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCn2nc(C)cc2C)c2ccccc2n1 |
| InChI | InChI=1S/C19H22N4O/c1-13-12-17(16-7-4-5-8-18(16)21-13)19(24)20-9-6-10-23-15(3)11-14(2)22-23/h4-5,7-8,11-12H,6,9-10H2,1-3H3,(H,20,24) |
| InChIKey | SCXUIQNTWYCJOC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|