C16H22N4O — CID 114536121
4-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylbenzamide (PubChem CID 114536121) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylbenzamide.
| Compound Name | 4-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 114536121 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylbenzamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2ccc(N)cc2C)n1 |
| InChI | InChI=1S/C16H22N4O/c1-11-9-14(17)5-6-15(11)16(21)18-7-4-8-20-13(3)10-12(2)19-20/h5-6,9-10H,4,7-8,17H2,1-3H3,(H,18,21) |
| InChIKey | RAZZPBYVCABLHV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|