C15H19ClN4O — CID 114536102
2-amino-6-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide (PubChem CID 114536102) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide.
| Compound Name | 2-amino-6-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 114536102 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-amino-6-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]benzamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2c(N)cccc2Cl)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-10-9-11(2)20(19-10)8-4-7-18-15(21)14-12(16)5-3-6-13(14)17/h3,5-6,9H,4,7-8,17H2,1-2H3,(H,18,21) |
| InChIKey | SKCVOWMXVKKALK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|