C16H21ClN4O2 — CID 119681221
4-amino-5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methoxybenzamide (PubChem CID 119681221) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 119681221 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-amino-5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C16H21ClN4O2/c1-10-7-11(2)21(20-10)6-4-5-19-16(22)12-8-13(17)14(18)9-15(12)23-3/h7-9H,4-6,18H2,1-3H3,(H,19,22) |
| InChIKey | QCCUKUQCWMACMC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|