C15H17BrFN3O — CID 51217423
2-bromo-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-fluorobenzamide (PubChem CID 51217423) has the molecular formula C15H17BrFN3O and a molecular weight of 354.22 g/mol. Its IUPAC name is 2-bromo-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-fluorobenzamide.
| Compound Name | 2-bromo-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 51217423 |
| Molecular Formula | C15H17BrFN3O |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-bromo-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-fluorobenzamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C15H17BrFN3O/c1-10-8-11(2)20(19-10)7-3-6-18-15(21)13-9-12(17)4-5-14(13)16/h4-5,8-9H,3,6-7H2,1-2H3,(H,18,21) |
| InChIKey | HOOGRSCUXBSPJA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|