C24H23FN4O — CID 18275614
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(4-fluorophenyl)quinoline-4-carboxamide (PubChem CID 18275614) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(4-fluorophenyl)quinoline-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(4-fluorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18275614 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(4-fluorophenyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)n1 |
| InChI | InChI=1S/C24H23FN4O/c1-16-14-17(2)29(28-16)13-5-12-26-24(30)21-15-23(18-8-10-19(25)11-9-18)27-22-7-4-3-6-20(21)22/h3-4,6-11,14-15H,5,12-13H2,1-2H3,(H,26,30) |
| InChIKey | UXKNOOXJZXRZHG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|