C14H14BrFN4O2 — CID 9425057
2-bromo-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-5-fluorobenzohydrazide (PubChem CID 9425057) has the molecular formula C14H14BrFN4O2 and a molecular weight of 369.19 g/mol. Its IUPAC name is 2-bromo-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-5-fluorobenzohydrazide.
| Compound Name | 2-bromo-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-5-fluorobenzohydrazide |
|---|---|
| PubChem CID | 9425057 |
| Molecular Formula | C14H14BrFN4O2 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-bromo-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-5-fluorobenzohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)c2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C14H14BrFN4O2/c1-8-5-9(2)20(19-8)7-13(21)17-18-14(22)11-6-10(16)3-4-12(11)15/h3-6H,7H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | GNFCYPQSLZTMQA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|