C15H18N4O4S — CID 4792234
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-methylsulfonylbenzohydrazide (PubChem CID 4792234) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-methylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 4792234 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-methylsulfonylbenzohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C15H18N4O4S/c1-10-8-11(2)19(18-10)9-14(20)16-17-15(21)12-4-6-13(7-5-12)24(3,22)23/h4-8H,9H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | GEYBBGSJKGBXFJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|