C16H17N7O2 — CID 26782232
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-(1,2,4-triazol-1-yl)benzohydrazide (PubChem CID 26782232) has the molecular formula C16H17N7O2 and a molecular weight of 339.36 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-(1,2,4-triazol-1-yl)benzohydrazide.
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-(1,2,4-triazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 26782232 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-4-(1,2,4-triazol-1-yl)benzohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)c2ccc(-n3cncn3)cc2)n1 |
| InChI | InChI=1S/C16H17N7O2/c1-11-7-12(2)22(21-11)8-15(24)19-20-16(25)13-3-5-14(6-4-13)23-10-17-9-18-23/h3-7,9-10H,8H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | ZCTWCPJHDBBVBB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|