C17H21N5O3 — CID 18280546
N-[2-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-2-oxoethyl]-3-methylbenzamide (PubChem CID 18280546) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[2-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | N-[2-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 18280546 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[2-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-2-oxoethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCC(=O)NNC(=O)Cn2nc(C)cc2C)c1 |
| InChI | InChI=1S/C17H21N5O3/c1-11-5-4-6-14(7-11)17(25)18-9-15(23)19-20-16(24)10-22-13(3)8-12(2)21-22/h4-8H,9-10H2,1-3H3,(H,18,25)(H,19,23)(H,20,24) |
| InChIKey | NIYYEBXDXOAVAE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|