C10H17N5OS — CID 4290547
1-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-ethylthiourea (PubChem CID 4290547) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 1-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-ethylthiourea.
| Compound Name | 1-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 4290547 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]amino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)Cn1nc(C)cc1C |
| InChI | InChI=1S/C10H17N5OS/c1-4-11-10(17)13-12-9(16)6-15-8(3)5-7(2)14-15/h5H,4,6H2,1-3H3,(H,12,16)(H2,11,13,17) |
| InChIKey | OIZIGWFSGCQCQK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|