C15H26N8S2 — CID 162740731
1-[(E)-[(3E)-1-(3,5-dimethylpyrazol-1-yl)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]-3-ethylthiourea (PubChem CID 162740731) has the molecular formula C15H26N8S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-[(E)-[(3E)-1-(3,5-dimethylpyrazol-1-yl)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]-3-ethylthiourea.
| Compound Name | 1-[(E)-[(3E)-1-(3,5-dimethylpyrazol-1-yl)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 162740731 |
| Molecular Formula | C15H26N8S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[(E)-[(3E)-1-(3,5-dimethylpyrazol-1-yl)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C(C)/C(Cn1nc(C)cc1C)=N/NC(=S)NCC |
| InChI | InChI=1S/C15H26N8S2/c1-6-16-14(24)20-18-12(5)13(19-21-15(25)17-7-2)9-23-11(4)8-10(3)22-23/h8H,6-7,9H2,1-5H3,(H2,16,20,24)(H2,17,21,25)/b18-12+,19-13+ |
| InChIKey | VHDJLAROOZWNJM-KLCVKJMQSA-N |
| XLogP | 1.20 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|