C10H20CuN6S2 — CID 10450672
copper-64;1-ethyl-3-[(Z)-[(3E)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea (PubChem CID 10450672) has the molecular formula C10H20CuN6S2 and a molecular weight of 352.38 g/mol. Its IUPAC name is copper-64;1-ethyl-3-[(Z)-[(3E)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea.
| Compound Name | copper-64;1-ethyl-3-[(Z)-[(3E)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 10450672 |
| Molecular Formula | C10H20CuN6S2 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | copper-64;1-ethyl-3-[(Z)-[(3E)-3-(ethylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C(C)\C(C)=N\NC(=S)NCC.[64Cu] |
| InChI | InChI=1S/C10H20N6S2.Cu/c1-5-11-9(17)15-13-7(3)8(4)14-16-10(18)12-6-2;/h5-6H2,1-4H3,(H2,11,15,17)(H2,12,16,18);/b13-7-,14-8+;/i;1+0 |
| InChIKey | AFQUBXKHFUSHKY-BKYVZOTBSA-N |
| XLogP | 0.70 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|