C8H13N3O4S — CID 101362014
(2Z)-2-(ethylcarbamothioylhydrazinylidene)pentanedioic acid (PubChem CID 101362014) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is (2Z)-2-(ethylcarbamothioylhydrazinylidene)pentanedioic acid.
| Compound Name | (2Z)-2-(ethylcarbamothioylhydrazinylidene)pentanedioic acid |
|---|---|
| PubChem CID | 101362014 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (2Z)-2-(ethylcarbamothioylhydrazinylidene)pentanedioic acid |
| SMILES | CCNC(=S)N/N=C(/CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13N3O4S/c1-2-9-8(16)11-10-5(7(14)15)3-4-6(12)13/h2-4H2,1H3,(H,12,13)(H,14,15)(H2,9,11,16)/b10-5- |
| InChIKey | VVCYQEXPRSCXFN-YHYXMXQVSA-N |
| XLogP | -0.22 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|