C8H16N6O2S2 — CID 2349980
1-ethyl-3-[[2-[2-(ethylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea (PubChem CID 2349980) has the molecular formula C8H16N6O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 1-ethyl-3-[[2-[2-(ethylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea.
| Compound Name | 1-ethyl-3-[[2-[2-(ethylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea |
|---|---|
| PubChem CID | 2349980 |
| Molecular Formula | C8H16N6O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-ethyl-3-[[2-[2-(ethylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea |
| SMILES | CCNC(=S)NNC(=O)C(=O)NNC(=S)NCC |
| InChI | InChI=1S/C8H16N6O2S2/c1-3-9-7(17)13-11-5(15)6(16)12-14-8(18)10-4-2/h3-4H2,1-2H3,(H,11,15)(H,12,16)(H2,9,13,17)(H2,10,14,18) |
| InChIKey | OYNQBSSMRRUUDV-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|