C12H24N6O2S2 — CID 3524813
1-butyl-3-[[2-[2-(butylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea (PubChem CID 3524813) has the molecular formula C12H24N6O2S2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 1-butyl-3-[[2-[2-(butylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea.
| Compound Name | 1-butyl-3-[[2-[2-(butylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea |
|---|---|
| PubChem CID | 3524813 |
| Molecular Formula | C12H24N6O2S2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-butyl-3-[[2-[2-(butylcarbamothioyl)hydrazinyl]-2-oxoacetyl]amino]thiourea |
| SMILES | CCCCNC(=S)NNC(=O)C(=O)NNC(=S)NCCCC |
| InChI | InChI=1S/C12H24N6O2S2/c1-3-5-7-13-11(21)17-15-9(19)10(20)16-18-12(22)14-8-6-4-2/h3-8H2,1-2H3,(H,15,19)(H,16,20)(H2,13,17,21)(H2,14,18,22) |
| InChIKey | LSLQCIORFNFONF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|