C8H16N6S2 — CID 177393867
1-ethyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)propylidene]amino]thiourea (PubChem CID 177393867) has the molecular formula C8H16N6S2 and a molecular weight of 260.39 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)propylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)propylidene]amino]thiourea |
|---|---|
| PubChem CID | 177393867 |
| Molecular Formula | C8H16N6S2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-ethyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)propylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C/C(C)=N/NC(=S)NC |
| InChI | InChI=1S/C8H16N6S2/c1-4-10-8(16)13-11-5-6(2)12-14-7(15)9-3/h5H,4H2,1-3H3,(H2,9,14,15)(H2,10,13,16)/b11-5+,12-6+ |
| InChIKey | BGCNUDYEEYLVPO-YDWXAUTNSA-N |
| XLogP | -0.07 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|